C14H32O6Si2 — CID 158965263
1-[2-[[methoxy-methyl-[2-(oxiran-2-ylmethoxy)ethyl]silyl]oxy-dimethylsilyl]ethoxy]propan-2-ol (PubChem CID 158965263) has the molecular formula C14H32O6Si2 and a molecular weight of 352.58 g/mol. Its IUPAC name is 1-[2-[[methoxy-methyl-[2-(oxiran-2-ylmethoxy)ethyl]silyl]oxy-dimethylsilyl]ethoxy]propan-2-ol.
| Compound Name | 1-[2-[[methoxy-methyl-[2-(oxiran-2-ylmethoxy)ethyl]silyl]oxy-dimethylsilyl]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 158965263 |
| Molecular Formula | C14H32O6Si2 |
| Molecular Weight | 352.58 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-[2-[[methoxy-methyl-[2-(oxiran-2-ylmethoxy)ethyl]silyl]oxy-dimethylsilyl]ethoxy]propan-2-ol |
| SMILES | CO[Si](C)(CCOCC1CO1)O[Si](C)(C)CCOCC(C)O |
| InChI | InChI=1S/C14H32O6Si2/c1-13(15)10-17-6-8-21(3,4)20-22(5,16-2)9-7-18-11-14-12-19-14/h13-15H,6-12H2,1-5H3 |
| InChIKey | ZZGWNTHPLARWSL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.58 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|