About N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide
N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide (PubChem CID 161271952) has the molecular formula C14H16N2O4
and a molecular weight of 276.29 g/mol. Its IUPAC name is N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide |
| PubChem CID | 161271952 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide |
| SMILES | CN(C(=O)c1ccc(=O)n(C)c1)C1CCC(=O)CC1=O |
| InChI | InChI=1S/C14H16N2O4/c1-15-8-9(3-6-13(15)19)14(20)16(2)11-5-4-10(17)7-12(11)18/h3,6,8,11H,4-5,7H2,1-2H3 |
| InChIKey | VDYAHWAKXLQWAU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide?
The IUPAC name of N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide (CID 161271952) is N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide.
What is the SMILES notation for N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide?
The canonical SMILES for N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide is CN(C(=O)c1ccc(=O)n(C)c1)C1CCC(=O)CC1=O.
What is the InChIKey of N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide?
The InChIKey is VDYAHWAKXLQWAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O4/c1-15-8-9(3-6-13(15)19)14(20)16(2)11-5-4-10(17)7-12(11)18/h3,6,8,11H,4-5,7H2,1-2H3.
What are the key properties of N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide?
N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide has a molecular weight of 276.29 g/mol, XLogP of 0.15, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dioxocyclohexyl)-N,1-dimethyl-6-oxopyridine-3-carboxamide is sourced from PubChem (CID 161271952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).