C11H16FN3O4 — CID 161273709
(2R,4R,5R)-4-fluoro-5-[4-(hydroxyamino)-2-methylidenepyrimidin-1-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 161273709) has the molecular formula C11H16FN3O4 and a molecular weight of 273.26 g/mol. Its IUPAC name is (2R,4R,5R)-4-fluoro-5-[4-(hydroxyamino)-2-methylidenepyrimidin-1-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2R,4R,5R)-4-fluoro-5-[4-(hydroxyamino)-2-methylidenepyrimidin-1-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 161273709 |
| Molecular Formula | C11H16FN3O4 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (2R,4R,5R)-4-fluoro-5-[4-(hydroxyamino)-2-methylidenepyrimidin-1-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | C=C1N=C(NO)C=CN1[C@@H]1O[C@H](CO)C(O)[C@@]1(C)F |
| InChI | InChI=1S/C11H16FN3O4/c1-6-13-8(14-18)3-4-15(6)10-11(2,12)9(17)7(5-16)19-10/h3-4,7,9-10,16-18H,1,5H2,2H3,(H,13,14)/t7-,9?,10-,11-/m1/s1 |
| InChIKey | FFXCYUJHJRYPKY-XWOKNADRSA-N |
| XLogP | -0.53 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|