About N,N-dimethyl-1-(1,2,4-triazol-1-yl)methanamine;vanadium
N,N-dimethyl-1-(1,2,4-triazol-1-yl)methanamine;vanadium (PubChem CID 161276001) has the molecular formula C5H10N4V
and a molecular weight of 177.11 g/mol. Its IUPAC name is N,N-dimethyl-1-(1,2,4-triazol-1-yl)methanamine;vanadium.
Analyze N,N-dimethyl-1-(1,2,4-triazol-1-yl)methanamine;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-(1,2,4-triazol-1-yl)methanamine;vanadium?
The IUPAC name of N,N-dimethyl-1-(1,2,4-triazol-1-yl)methanamine;vanadium (CID 161276001) is N,N-dimethyl-1-(1,2,4-triazol-1-yl)methanamine;vanadium.
What is the SMILES notation for N,N-dimethyl-1-(1,2,4-triazol-1-yl)methanamine;vanadium?
The canonical SMILES for N,N-dimethyl-1-(1,2,4-triazol-1-yl)methanamine;vanadium is CN(C)Cn1cncn1.[V].
What is the InChIKey of N,N-dimethyl-1-(1,2,4-triazol-1-yl)methanamine;vanadium?
The InChIKey is VELHCIJNFYTUDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4.V/c1-8(2)5-9-4-6-3-7-9;/h3-4H,5H2,1-2H3;.
What are the key properties of N,N-dimethyl-1-(1,2,4-triazol-1-yl)methanamine;vanadium?
N,N-dimethyl-1-(1,2,4-triazol-1-yl)methanamine;vanadium has a molecular weight of 177.11 g/mol, XLogP of -0.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-(1,2,4-triazol-1-yl)methanamine;vanadium is sourced from PubChem (CID 161276001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).