C31H46N4 — CID 126566325
N-(1,2,4-triazol-1-ylmethyl)-4-(2,4,4-trimethylpentan-2-yl)-N-[4-(2,4,4-trimethylpentan-2-yl)phenyl]aniline (PubChem CID 126566325) has the molecular formula C31H46N4 and a molecular weight of 474.74 g/mol. Its IUPAC name is N-(1,2,4-triazol-1-ylmethyl)-4-(2,4,4-trimethylpentan-2-yl)-N-[4-(2,4,4-trimethylpentan-2-yl)phenyl]aniline.
| Compound Name | N-(1,2,4-triazol-1-ylmethyl)-4-(2,4,4-trimethylpentan-2-yl)-N-[4-(2,4,4-trimethylpentan-2-yl)phenyl]aniline |
|---|---|
| PubChem CID | 126566325 |
| Molecular Formula | C31H46N4 |
| Molecular Weight | 474.74 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | N-(1,2,4-triazol-1-ylmethyl)-4-(2,4,4-trimethylpentan-2-yl)-N-[4-(2,4,4-trimethylpentan-2-yl)phenyl]aniline |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(N(Cn2cncn2)c2ccc(C(C)(C)CC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H46N4/c1-28(2,3)19-30(7,8)24-11-15-26(16-12-24)35(23-34-22-32-21-33-34)27-17-13-25(14-18-27)31(9,10)20-29(4,5)6/h11-18,21-22H,19-20,23H2,1-10H3 |
| InChIKey | VLVYPZCSBZIMPE-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.74 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |