C6H9ClN4O — CID 131847612
N-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl chloride (PubChem CID 131847612) has the molecular formula C6H9ClN4O and a molecular weight of 188.62 g/mol. Its IUPAC name is N-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl chloride.
| Compound Name | N-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl chloride |
|---|---|
| PubChem CID | 131847612 |
| Molecular Formula | C6H9ClN4O |
| Molecular Weight | 188.62 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | N-methyl-N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl chloride |
| SMILES | CN(CCn1cncn1)C(=O)Cl |
| InChI | InChI=1S/C6H9ClN4O/c1-10(6(7)12)2-3-11-5-8-4-9-11/h4-5H,2-3H2,1H3 |
| InChIKey | AVGMBZSIXUJWBD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.62 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|