C21H28F3NO4S — CID 161282257
7,7-dimethyl-1-(trioxidanylsulfanylmethyl)bicyclo[2.2.1]heptan-2-one;(3S)-3-[2-(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 161282257) has the molecular formula C21H28F3NO4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 7,7-dimethyl-1-(trioxidanylsulfanylmethyl)bicyclo[2.2.1]heptan-2-one;(3S)-3-[2-(trifluoromethyl)phenyl]pyrrolidine.
| Compound Name | 7,7-dimethyl-1-(trioxidanylsulfanylmethyl)bicyclo[2.2.1]heptan-2-one;(3S)-3-[2-(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 161282257 |
| Molecular Formula | C21H28F3NO4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 7,7-dimethyl-1-(trioxidanylsulfanylmethyl)bicyclo[2.2.1]heptan-2-one;(3S)-3-[2-(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | CC1(C)C2CCC1(CSOOO)C(=O)C2.FC(F)(F)c1ccccc1[C@@H]1CCNC1 |
| InChI | InChI=1S/C11H12F3N.C10H16O4S/c12-11(13,14)10-4-2-1-3-9(10)8-5-6-15-7-8;1-9(2)7-3-4-10(9,8(11)5-7)6-15-14-13-12/h1-4,8,15H,5-7H2;7,12H,3-6H2,1-2H3/t8-;/m1./s1 |
| InChIKey | VFGAJROWFQMEJP-DDWIOCJRSA-N |
| XLogP | 5.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|