C26H26Cl2N4O3 — CID 161285967
5-chloro-1-[1-(4-chlorophenyl)ethyl]-N-[7-(4-methoxypyrimidin-2-yl)hept-3-ynyl]-2-oxopyridine-3-carboxamide (PubChem CID 161285967) has the molecular formula C26H26Cl2N4O3 and a molecular weight of 513.43 g/mol. Its IUPAC name is 5-chloro-1-[1-(4-chlorophenyl)ethyl]-N-[7-(4-methoxypyrimidin-2-yl)hept-3-ynyl]-2-oxopyridine-3-carboxamide.
| Compound Name | 5-chloro-1-[1-(4-chlorophenyl)ethyl]-N-[7-(4-methoxypyrimidin-2-yl)hept-3-ynyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 161285967 |
| Molecular Formula | C26H26Cl2N4O3 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 5-chloro-1-[1-(4-chlorophenyl)ethyl]-N-[7-(4-methoxypyrimidin-2-yl)hept-3-ynyl]-2-oxopyridine-3-carboxamide |
| SMILES | COc1ccnc(CCCC#CCCNC(=O)c2cc(Cl)cn(C(C)c3ccc(Cl)cc3)c2=O)n1 |
| InChI | InChI=1S/C26H26Cl2N4O3/c1-18(19-9-11-20(27)12-10-19)32-17-21(28)16-22(26(32)34)25(33)30-14-7-5-3-4-6-8-23-29-15-13-24(31-23)35-2/h9-13,15-18H,4,6-8,14H2,1-2H3,(H,30,33) |
| InChIKey | DAHXZYLENVGGHJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|