C25H27F2N3O3 — CID 159743186
1-[(3,4-difluorophenyl)methyl]-3-[8-(4-methoxypyrimidin-2-yl)octanoyl]pyridin-2-one (PubChem CID 159743186) has the molecular formula C25H27F2N3O3 and a molecular weight of 455.51 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-3-[8-(4-methoxypyrimidin-2-yl)octanoyl]pyridin-2-one.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-3-[8-(4-methoxypyrimidin-2-yl)octanoyl]pyridin-2-one |
|---|---|
| PubChem CID | 159743186 |
| Molecular Formula | C25H27F2N3O3 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-3-[8-(4-methoxypyrimidin-2-yl)octanoyl]pyridin-2-one |
| SMILES | COc1ccnc(CCCCCCCC(=O)c2cccn(Cc3ccc(F)c(F)c3)c2=O)n1 |
| InChI | InChI=1S/C25H27F2N3O3/c1-33-24-13-14-28-23(29-24)10-6-4-2-3-5-9-22(31)19-8-7-15-30(25(19)32)17-18-11-12-20(26)21(27)16-18/h7-8,11-16H,2-6,9-10,17H2,1H3 |
| InChIKey | IUQLEEJYRSCOGI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|