C25H23F2NO4 — CID 159666432
1-[(3,4-difluorophenyl)methyl]-3-[4-[4-(2-oxopropyl)phenoxy]butanoyl]pyridin-2-one (PubChem CID 159666432) has the molecular formula C25H23F2NO4 and a molecular weight of 439.46 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-3-[4-[4-(2-oxopropyl)phenoxy]butanoyl]pyridin-2-one.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-3-[4-[4-(2-oxopropyl)phenoxy]butanoyl]pyridin-2-one |
|---|---|
| PubChem CID | 159666432 |
| Molecular Formula | C25H23F2NO4 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-3-[4-[4-(2-oxopropyl)phenoxy]butanoyl]pyridin-2-one |
| SMILES | CC(=O)Cc1ccc(OCCCC(=O)c2cccn(Cc3ccc(F)c(F)c3)c2=O)cc1 |
| InChI | InChI=1S/C25H23F2NO4/c1-17(29)14-18-6-9-20(10-7-18)32-13-3-5-24(30)21-4-2-12-28(25(21)31)16-19-8-11-22(26)23(27)15-19/h2,4,6-12,15H,3,5,13-14,16H2,1H3 |
| InChIKey | KQCQRVPQMKIPFD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|