C29H30F2N4O4 — CID 147186883
6-[4-[1-[(3,4-difluorophenyl)methyl]-2-oxo-3-pyridinyl]-4-oxobutoxy]-3-(2-pyrrolidin-1-ylethyl)-1H-benzimidazol-2-one (PubChem CID 147186883) has the molecular formula C29H30F2N4O4 and a molecular weight of 536.58 g/mol. Its IUPAC name is 6-[4-[1-[(3,4-difluorophenyl)methyl]-2-oxo-3-pyridinyl]-4-oxobutoxy]-3-(2-pyrrolidin-1-ylethyl)-1H-benzimidazol-2-one.
| Compound Name | 6-[4-[1-[(3,4-difluorophenyl)methyl]-2-oxo-3-pyridinyl]-4-oxobutoxy]-3-(2-pyrrolidin-1-ylethyl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 147186883 |
| Molecular Formula | C29H30F2N4O4 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 6-[4-[1-[(3,4-difluorophenyl)methyl]-2-oxo-3-pyridinyl]-4-oxobutoxy]-3-(2-pyrrolidin-1-ylethyl)-1H-benzimidazol-2-one |
| SMILES | O=C(CCCOc1ccc2c(c1)[nH]c(=O)n2CCN1CCCC1)c1cccn(Cc2ccc(F)c(F)c2)c1=O |
| InChI | InChI=1S/C29H30F2N4O4/c30-23-9-7-20(17-24(23)31)19-34-13-3-5-22(28(34)37)27(36)6-4-16-39-21-8-10-26-25(18-21)32-29(38)35(26)15-14-33-11-1-2-12-33/h3,5,7-10,13,17-18H,1-2,4,6,11-12,14-16,19H2,(H,32,38) |
| InChIKey | CAQWDEOAZKPVJE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|