C26H23F3N2O4 — CID 159651260
ethene;6-[4-oxo-4-[2-oxo-1-[(3,4,5-trifluorophenyl)methyl]-3-pyridinyl]butoxy]-1,3-dihydroindol-2-one (PubChem CID 159651260) has the molecular formula C26H23F3N2O4 and a molecular weight of 484.47 g/mol. Its IUPAC name is ethene;6-[4-oxo-4-[2-oxo-1-[(3,4,5-trifluorophenyl)methyl]-3-pyridinyl]butoxy]-1,3-dihydroindol-2-one.
| Compound Name | ethene;6-[4-oxo-4-[2-oxo-1-[(3,4,5-trifluorophenyl)methyl]-3-pyridinyl]butoxy]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 159651260 |
| Molecular Formula | C26H23F3N2O4 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | ethene;6-[4-oxo-4-[2-oxo-1-[(3,4,5-trifluorophenyl)methyl]-3-pyridinyl]butoxy]-1,3-dihydroindol-2-one |
| SMILES | C=C.O=C1Cc2ccc(OCCCC(=O)c3cccn(Cc4cc(F)c(F)c(F)c4)c3=O)cc2N1 |
| InChI | InChI=1S/C24H19F3N2O4.C2H4/c25-18-9-14(10-19(26)23(18)27)13-29-7-1-3-17(24(29)32)21(30)4-2-8-33-16-6-5-15-11-22(31)28-20(15)12-16;1-2/h1,3,5-7,9-10,12H,2,4,8,11,13H2,(H,28,31);1-2H2 |
| InChIKey | MRPGAVNEIIWOBJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|