C19H18F3NO3 — CID 160776895
3-[(3R)-3-cyclopropyl-4-hydroxybutanoyl]-1-[(3,4,5-trifluorophenyl)methyl]pyridin-2-one (PubChem CID 160776895) has the molecular formula C19H18F3NO3 and a molecular weight of 365.35 g/mol. Its IUPAC name is 3-[(3R)-3-cyclopropyl-4-hydroxybutanoyl]-1-[(3,4,5-trifluorophenyl)methyl]pyridin-2-one.
| Compound Name | 3-[(3R)-3-cyclopropyl-4-hydroxybutanoyl]-1-[(3,4,5-trifluorophenyl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 160776895 |
| Molecular Formula | C19H18F3NO3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-[(3R)-3-cyclopropyl-4-hydroxybutanoyl]-1-[(3,4,5-trifluorophenyl)methyl]pyridin-2-one |
| SMILES | O=C(C[C@@H](CO)C1CC1)c1cccn(Cc2cc(F)c(F)c(F)c2)c1=O |
| InChI | InChI=1S/C19H18F3NO3/c20-15-6-11(7-16(21)18(15)22)9-23-5-1-2-14(19(23)26)17(25)8-13(10-24)12-3-4-12/h1-2,5-7,12-13,24H,3-4,8-10H2/t13-/m0/s1 |
| InChIKey | RTSCEQCKSNJCIZ-ZDUSSCGKSA-N |
| XLogP | 2.91 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|