C24H21F3N4O2 — CID 59362697
2-oxo-N-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)butyl]-1-[(3,4,5-trifluorophenyl)methyl]pyridine-3-carboxamide (PubChem CID 59362697) has the molecular formula C24H21F3N4O2 and a molecular weight of 454.45 g/mol. Its IUPAC name is 2-oxo-N-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)butyl]-1-[(3,4,5-trifluorophenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)butyl]-1-[(3,4,5-trifluorophenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59362697 |
| Molecular Formula | C24H21F3N4O2 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 2-oxo-N-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)butyl]-1-[(3,4,5-trifluorophenyl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCCCc1c[nH]c2ncccc12)c1cccn(Cc2cc(F)c(F)c(F)c2)c1=O |
| InChI | InChI=1S/C24H21F3N4O2/c25-19-11-15(12-20(26)21(19)27)14-31-10-4-7-18(24(31)33)23(32)29-8-2-1-5-16-13-30-22-17(16)6-3-9-28-22/h3-4,6-7,9-13H,1-2,5,8,14H2,(H,28,30)(H,29,32) |
| InChIKey | GDUKNQVCIYODKW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|