C27H20F2N4O3 — CID 153041308
1-[(3,4-difluorophenyl)methyl]-3-[3-[1-oxido-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-1-ium-3-yl]propanoyl]pyridin-2-one (PubChem CID 153041308) has the molecular formula C27H20F2N4O3 and a molecular weight of 486.48 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-3-[3-[1-oxido-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-1-ium-3-yl]propanoyl]pyridin-2-one.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-3-[3-[1-oxido-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-1-ium-3-yl]propanoyl]pyridin-2-one |
|---|---|
| PubChem CID | 153041308 |
| Molecular Formula | C27H20F2N4O3 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-3-[3-[1-oxido-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyridin-1-ium-3-yl]propanoyl]pyridin-2-one |
| SMILES | O=C(CCc1cc(-c2c[nH]c3ncccc23)c[n+]([O-])c1)c1cccn(Cc2ccc(F)c(F)c2)c1=O |
| InChI | InChI=1S/C27H20F2N4O3/c28-23-7-5-18(12-24(23)29)14-32-10-2-4-21(27(32)35)25(34)8-6-17-11-19(16-33(36)15-17)22-13-31-26-20(22)3-1-9-30-26/h1-5,7,9-13,15-16H,6,8,14H2,(H,30,31) |
| InChIKey | VFSYFSKNERRWCH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|