C27H21ClN4O2 — CID 58499260
1-[(6-chloro-3-pyridinyl)methyl]-3-[3-[3-(1H-pyrrolo[2,3-b]pyridin-3-yl)phenyl]propanoyl]pyridin-2-one (PubChem CID 58499260) has the molecular formula C27H21ClN4O2 and a molecular weight of 468.94 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-3-[3-[3-(1H-pyrrolo[2,3-b]pyridin-3-yl)phenyl]propanoyl]pyridin-2-one.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-[3-[3-(1H-pyrrolo[2,3-b]pyridin-3-yl)phenyl]propanoyl]pyridin-2-one |
|---|---|
| PubChem CID | 58499260 |
| Molecular Formula | C27H21ClN4O2 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-3-[3-[3-(1H-pyrrolo[2,3-b]pyridin-3-yl)phenyl]propanoyl]pyridin-2-one |
| SMILES | O=C(CCc1cccc(-c2c[nH]c3ncccc23)c1)c1cccn(Cc2ccc(Cl)nc2)c1=O |
| InChI | InChI=1S/C27H21ClN4O2/c28-25-11-9-19(15-30-25)17-32-13-3-7-22(27(32)34)24(33)10-8-18-4-1-5-20(14-18)23-16-31-26-21(23)6-2-12-29-26/h1-7,9,11-16H,8,10,17H2,(H,29,31) |
| InChIKey | XATMEFCSGKYLRJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|