C25H25Cl2N5O3 — CID 59362516
5-chloro-1-[1-(4-chlorophenyl)ethyl]-N-[6-[(4-methoxypyrimidin-2-yl)amino]hex-3-ynyl]-2-oxopyridine-3-carboxamide (PubChem CID 59362516) has the molecular formula C25H25Cl2N5O3 and a molecular weight of 514.41 g/mol. Its IUPAC name is 5-chloro-1-[1-(4-chlorophenyl)ethyl]-N-[6-[(4-methoxypyrimidin-2-yl)amino]hex-3-ynyl]-2-oxopyridine-3-carboxamide.
| Compound Name | 5-chloro-1-[1-(4-chlorophenyl)ethyl]-N-[6-[(4-methoxypyrimidin-2-yl)amino]hex-3-ynyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 59362516 |
| Molecular Formula | C25H25Cl2N5O3 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 5-chloro-1-[1-(4-chlorophenyl)ethyl]-N-[6-[(4-methoxypyrimidin-2-yl)amino]hex-3-ynyl]-2-oxopyridine-3-carboxamide |
| SMILES | COc1ccnc(NCCC#CCCNC(=O)c2cc(Cl)cn(C(C)c3ccc(Cl)cc3)c2=O)n1 |
| InChI | InChI=1S/C25H25Cl2N5O3/c1-17(18-7-9-19(26)10-8-18)32-16-20(27)15-21(24(32)34)23(33)28-12-5-3-4-6-13-29-25-30-14-11-22(31-25)35-2/h7-11,14-17H,5-6,12-13H2,1-2H3,(H,28,33)(H,29,30,31) |
| InChIKey | VKYYBVFULCEVQL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|