C25H25Cl2N5O2 — CID 134185437
5-chloro-1-[(3-chlorophenyl)methyl]-N-[6-[(4-ethylpyrimidin-2-yl)amino]hex-3-ynyl]-2-oxopyridine-3-carboxamide (PubChem CID 134185437) has the molecular formula C25H25Cl2N5O2 and a molecular weight of 498.41 g/mol. Its IUPAC name is 5-chloro-1-[(3-chlorophenyl)methyl]-N-[6-[(4-ethylpyrimidin-2-yl)amino]hex-3-ynyl]-2-oxopyridine-3-carboxamide.
| Compound Name | 5-chloro-1-[(3-chlorophenyl)methyl]-N-[6-[(4-ethylpyrimidin-2-yl)amino]hex-3-ynyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 134185437 |
| Molecular Formula | C25H25Cl2N5O2 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 5-chloro-1-[(3-chlorophenyl)methyl]-N-[6-[(4-ethylpyrimidin-2-yl)amino]hex-3-ynyl]-2-oxopyridine-3-carboxamide |
| SMILES | CCc1ccnc(NCCC#CCCNC(=O)c2cc(Cl)cn(Cc3cccc(Cl)c3)c2=O)n1 |
| InChI | InChI=1S/C25H25Cl2N5O2/c1-2-21-10-13-30-25(31-21)29-12-6-4-3-5-11-28-23(33)22-15-20(27)17-32(24(22)34)16-18-8-7-9-19(26)14-18/h7-10,13-15,17H,2,5-6,11-12,16H2,1H3,(H,28,33)(H,29,30,31) |
| InChIKey | MKWWUQFTGSCZOH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|