C26H29N5O3 — CID 123912404
N-[6-[(4-methoxypyrimidin-2-yl)amino]hex-3-ynyl]-5-methyl-1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carboxamide (PubChem CID 123912404) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[6-[(4-methoxypyrimidin-2-yl)amino]hex-3-ynyl]-5-methyl-1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carboxamide.
| Compound Name | N-[6-[(4-methoxypyrimidin-2-yl)amino]hex-3-ynyl]-5-methyl-1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 123912404 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-[6-[(4-methoxypyrimidin-2-yl)amino]hex-3-ynyl]-5-methyl-1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carboxamide |
| SMILES | COc1ccnc(NCCC#CCCNC(=O)c2cc(C)cn(Cc3cccc(C)c3)c2=O)n1 |
| InChI | InChI=1S/C26H29N5O3/c1-19-9-8-10-21(15-19)18-31-17-20(2)16-22(25(31)33)24(32)27-12-6-4-5-7-13-28-26-29-14-11-23(30-26)34-3/h8-11,14-17H,6-7,12-13,18H2,1-3H3,(H,27,32)(H,28,29,30) |
| InChIKey | ZFNNABPKOPMUPM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|