C17H19N3O4 — CID 161287727
(2S)-2-amino-3-phenylpropanoic acid;benzene-1,4-dicarboxamide (PubChem CID 161287727) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;benzene-1,4-dicarboxamide.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 161287727 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)cc1.N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2.C8H8N2O2/c10-8(9(11)12)6-7-4-2-1-3-5-7;9-7(11)5-1-2-6(4-3-5)8(10)12/h1-5,8H,6,10H2,(H,11,12);1-4H,(H2,9,11)(H2,10,12)/t8-;/m0./s1 |
| InChIKey | VFYAINBXLOLGEF-QRPNPIFTSA-N |
| XLogP | 0.53 |
| TPSA | 149.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |