C43H35N3 — CID 161289757
4,5-bis(1,8-dimethylcarbazol-9-yl)-2-(2,4-dimethylphenyl)benzonitrile (PubChem CID 161289757) has the molecular formula C43H35N3 and a molecular weight of 593.77 g/mol. Its IUPAC name is 4,5-bis(1,8-dimethylcarbazol-9-yl)-2-(2,4-dimethylphenyl)benzonitrile.
| Compound Name | 4,5-bis(1,8-dimethylcarbazol-9-yl)-2-(2,4-dimethylphenyl)benzonitrile |
|---|---|
| PubChem CID | 161289757 |
| Molecular Formula | C43H35N3 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | 4,5-bis(1,8-dimethylcarbazol-9-yl)-2-(2,4-dimethylphenyl)benzonitrile |
| SMILES | Cc1ccc(-c2cc(-n3c4c(C)cccc4c4cccc(C)c43)c(-n3c4c(C)cccc4c4cccc(C)c43)cc2C#N)c(C)c1 |
| InChI | InChI=1S/C43H35N3/c1-25-19-20-32(30(6)21-25)37-23-39(46-42-28(4)13-9-17-35(42)36-18-10-14-29(5)43(36)46)38(22-31(37)24-44)45-40-26(2)11-7-15-33(40)34-16-8-12-27(3)41(34)45/h7-23H,1-6H3 |
| InChIKey | FPZXIZCGILHIPL-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |