C13H20N2O — CID 161292295
(3E)-5-(5-tert-butyl-3-methylpyrazol-1-yl)penta-1,3-dien-2-ol (PubChem CID 161292295) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is (3E)-5-(5-tert-butyl-3-methylpyrazol-1-yl)penta-1,3-dien-2-ol.
| Compound Name | (3E)-5-(5-tert-butyl-3-methylpyrazol-1-yl)penta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 161292295 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (3E)-5-(5-tert-butyl-3-methylpyrazol-1-yl)penta-1,3-dien-2-ol |
| SMILES | C=C(O)/C=C/Cn1nc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C13H20N2O/c1-10-9-12(13(3,4)5)15(14-10)8-6-7-11(2)16/h6-7,9,16H,2,8H2,1,3-5H3/b7-6+ |
| InChIKey | GRUZHEPDUKRUPA-VOTSOKGWSA-N |
| XLogP | 3.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|