About 5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole
5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole (PubChem CID 165024911) has the molecular formula C20H35FN4
and a molecular weight of 350.53 g/mol. Its IUPAC name is 5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole.
Molecular Properties
| Compound Name | 5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole |
| PubChem CID | 165024911 |
| Molecular Formula | C20H35FN4 |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | 5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole |
| SMILES | CCn1nc(C)c(F)c1C(C)(C)C.CCn1nc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C10H17FN2.C10H18N2/c1-6-13-9(10(3,4)5)8(11)7(2)12-13;1-6-12-9(10(3,4)5)7-8(2)11-12/h6H2,1-5H3;7H,6H2,1-5H3 |
| InChIKey | LSMYBXQXJJDOJA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole?
The IUPAC name of 5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole (CID 165024911) is 5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole.
What is the SMILES notation for 5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole?
The canonical SMILES for 5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole is CCn1nc(C)c(F)c1C(C)(C)C.CCn1nc(C)cc1C(C)(C)C.
What is the InChIKey of 5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole?
The InChIKey is LSMYBXQXJJDOJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17FN2.C10H18N2/c1-6-13-9(10(3,4)5)8(11)7(2)12-13;1-6-12-9(10(3,4)5)7-8(2)11-12/h6H2,1-5H3;7H,6H2,1-5H3.
What are the key properties of 5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole?
5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole has a molecular weight of 350.53 g/mol, XLogP of 5.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1-ethyl-4-fluoro-3-methylpyrazole;5-tert-butyl-1-ethyl-3-methylpyrazole is sourced from PubChem (CID 165024911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).