C15H23N3 — CID 166833552
5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-ethylpyrazole (PubChem CID 166833552) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-ethylpyrazole.
| Compound Name | 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-ethylpyrazole |
|---|---|
| PubChem CID | 166833552 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-ethylpyrazole |
| SMILES | CCn1nc(-n2c(C)ccc2C)cc1C(C)(C)C |
| InChI | InChI=1S/C15H23N3/c1-7-17-13(15(4,5)6)10-14(16-17)18-11(2)8-9-12(18)3/h8-10H,7H2,1-6H3 |
| InChIKey | KKXAWTIMFXSTBT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_E(5)', 'substructure': 'N/A'} |
|---|