C24H31N3O — CID 157042149
5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-(3-phenylmethoxycyclobutyl)pyrazole (PubChem CID 157042149) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-(3-phenylmethoxycyclobutyl)pyrazole.
| Compound Name | 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-(3-phenylmethoxycyclobutyl)pyrazole |
|---|---|
| PubChem CID | 157042149 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 5-tert-butyl-3-(2,5-dimethylpyrrol-1-yl)-1-(3-phenylmethoxycyclobutyl)pyrazole |
| SMILES | Cc1ccc(C)n1-c1cc(C(C)(C)C)n(C2CC(OCc3ccccc3)C2)n1 |
| InChI | InChI=1S/C24H31N3O/c1-17-11-12-18(2)26(17)23-15-22(24(3,4)5)27(25-23)20-13-21(14-20)28-16-19-9-7-6-8-10-19/h6-12,15,20-21H,13-14,16H2,1-5H3 |
| InChIKey | KQBCRCZBZUHDSN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_E(5)', 'substructure': 'N/A'} |
|---|