C19H20I2O3 — CID 163688730
1-(1,1-diiodoethoxy)-3-(3-phenylmethoxycyclobutyl)oxybenzene (PubChem CID 163688730) has the molecular formula C19H20I2O3 and a molecular weight of 550.17 g/mol. Its IUPAC name is 1-(1,1-diiodoethoxy)-3-(3-phenylmethoxycyclobutyl)oxybenzene.
| Compound Name | 1-(1,1-diiodoethoxy)-3-(3-phenylmethoxycyclobutyl)oxybenzene |
|---|---|
| PubChem CID | 163688730 |
| Molecular Formula | C19H20I2O3 |
| Molecular Weight | 550.17 g/mol |
| Exact Mass | 549.95 |
| IUPAC Name | 1-(1,1-diiodoethoxy)-3-(3-phenylmethoxycyclobutyl)oxybenzene |
| SMILES | CC(I)(I)Oc1cccc(OC2CC(OCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C19H20I2O3/c1-19(20,21)24-16-9-5-8-15(10-16)23-18-11-17(12-18)22-13-14-6-3-2-4-7-14/h2-10,17-18H,11-13H2,1H3 |
| InChIKey | JRDFYSFWRQWXHH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.17 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|