C17H24F2O2 — CID 134489222
[3-(4,4-difluorohexoxy)cyclobutyl]oxymethylbenzene (PubChem CID 134489222) has the molecular formula C17H24F2O2 and a molecular weight of 298.37 g/mol. Its IUPAC name is [3-(4,4-difluorohexoxy)cyclobutyl]oxymethylbenzene.
| Compound Name | [3-(4,4-difluorohexoxy)cyclobutyl]oxymethylbenzene |
|---|---|
| PubChem CID | 134489222 |
| Molecular Formula | C17H24F2O2 |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [3-(4,4-difluorohexoxy)cyclobutyl]oxymethylbenzene |
| SMILES | CCC(F)(F)CCCOC1CC(OCc2ccccc2)C1 |
| InChI | InChI=1S/C17H24F2O2/c1-2-17(18,19)9-6-10-20-15-11-16(12-15)21-13-14-7-4-3-5-8-14/h3-5,7-8,15-16H,2,6,9-13H2,1H3 |
| InChIKey | ANLMMZKTBHRBCX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|