C16H22F2IO3P — CID 134492863
[2,2-difluoro-5-(3-phenylmethoxycyclobutyl)oxypentoxy]-iodophosphane (PubChem CID 134492863) has the molecular formula C16H22F2IO3P and a molecular weight of 458.22 g/mol. Its IUPAC name is [2,2-difluoro-5-(3-phenylmethoxycyclobutyl)oxypentoxy]-iodophosphane.
| Compound Name | [2,2-difluoro-5-(3-phenylmethoxycyclobutyl)oxypentoxy]-iodophosphane |
|---|---|
| PubChem CID | 134492863 |
| Molecular Formula | C16H22F2IO3P |
| Molecular Weight | 458.22 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | [2,2-difluoro-5-(3-phenylmethoxycyclobutyl)oxypentoxy]-iodophosphane |
| SMILES | FC(F)(CCCOC1CC(OCc2ccccc2)C1)COPI |
| InChI | InChI=1S/C16H22F2IO3P/c17-16(18,12-22-23-19)7-4-8-20-14-9-15(10-14)21-11-13-5-2-1-3-6-13/h1-3,5-6,14-15,23H,4,7-12H2 |
| InChIKey | SHHANSXSGPXHDX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.22 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|