C27H33N3O4 — CID 157042430
1-[3,3-bis(phenylmethoxymethyl)cyclobutyl]-5-tert-butyl-3-nitropyrazole (PubChem CID 157042430) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is 1-[3,3-bis(phenylmethoxymethyl)cyclobutyl]-5-tert-butyl-3-nitropyrazole.
| Compound Name | 1-[3,3-bis(phenylmethoxymethyl)cyclobutyl]-5-tert-butyl-3-nitropyrazole |
|---|---|
| PubChem CID | 157042430 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 1-[3,3-bis(phenylmethoxymethyl)cyclobutyl]-5-tert-butyl-3-nitropyrazole |
| SMILES | CC(C)(C)c1cc([N+](=O)[O-])nn1C1CC(COCc2ccccc2)(COCc2ccccc2)C1 |
| InChI | InChI=1S/C27H33N3O4/c1-26(2,3)24-14-25(30(31)32)28-29(24)23-15-27(16-23,19-33-17-21-10-6-4-7-11-21)20-34-18-22-12-8-5-9-13-22/h4-14,23H,15-20H2,1-3H3 |
| InChIKey | CGKQEPXPXYHJOU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|