C9H8BrF3NY- — CID 161297791
5-bromo-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium (PubChem CID 161297791) has the molecular formula C9H8BrF3NY- and a molecular weight of 355.97 g/mol. Its IUPAC name is 5-bromo-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium.
| Compound Name | 5-bromo-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium |
|---|---|
| PubChem CID | 161297791 |
| Molecular Formula | C9H8BrF3NY- |
| Molecular Weight | 355.97 g/mol |
| Exact Mass | 354.89 |
| IUPAC Name | 5-bromo-3-methyl-6-methylidene-1-(2,2,2-trifluoroethyl)-2H-pyridin-2-ide;yttrium |
| SMILES | C=C1C(Br)=CC(C)=[C-]N1CC(F)(F)F.[Y] |
| InChI | InChI=1S/C9H8BrF3N.Y/c1-6-3-8(10)7(2)14(4-6)5-9(11,12)13;/h3H,2,5H2,1H3;/q-1; |
| InChIKey | SLVJJTKHYLVUTB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.97 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|