C19H36F4 — CID 161297880
cis-(3S,4R)-1-fluoro-1,3,4-trimethylcyclohexane;cis-(4S,5R)-1,1,2-trifluoro-2,4,5-trimethylcyclohexane;methane (PubChem CID 161297880) has the molecular formula C19H36F4 and a molecular weight of 340.49 g/mol. Its IUPAC name is cis-(3S,4R)-1-fluoro-1,3,4-trimethylcyclohexane;cis-(4S,5R)-1,1,2-trifluoro-2,4,5-trimethylcyclohexane;methane.
| Compound Name | cis-(3S,4R)-1-fluoro-1,3,4-trimethylcyclohexane;cis-(4S,5R)-1,1,2-trifluoro-2,4,5-trimethylcyclohexane;methane |
|---|---|
| PubChem CID | 161297880 |
| Molecular Formula | C19H36F4 |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | cis-(3S,4R)-1-fluoro-1,3,4-trimethylcyclohexane;cis-(4S,5R)-1,1,2-trifluoro-2,4,5-trimethylcyclohexane;methane |
| SMILES | C.C[C@@H]1CC(F)(F)C(C)(F)C[C@@H]1C.C[C@@H]1CCC(C)(F)C[C@@H]1C |
| InChI | InChI=1S/C9H15F3.C9H17F.CH4/c1-6-4-8(3,10)9(11,12)5-7(6)2;1-7-4-5-9(3,10)6-8(7)2;/h6-7H,4-5H2,1-3H3;7-8H,4-6H2,1-3H3;1H4/t6-,7+,8?;7-,8+,9?;/m01./s1 |
| InChIKey | VHFHDILPXNEXNR-XEGUHHJWSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |