C26H41N2O2+ — CID 161299085
[(2S)-1-benzyl-1-methylpyrrolidin-1-ium-2-yl]methanol;[(2S)-1-benzylpyrrolidin-2-yl]methanol;methane (PubChem CID 161299085) has the molecular formula C26H41N2O2+ and a molecular weight of 413.63 g/mol. Its IUPAC name is [(2S)-1-benzyl-1-methylpyrrolidin-1-ium-2-yl]methanol;[(2S)-1-benzylpyrrolidin-2-yl]methanol;methane.
| Compound Name | [(2S)-1-benzyl-1-methylpyrrolidin-1-ium-2-yl]methanol;[(2S)-1-benzylpyrrolidin-2-yl]methanol;methane |
|---|---|
| PubChem CID | 161299085 |
| Molecular Formula | C26H41N2O2+ |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.32 |
| IUPAC Name | [(2S)-1-benzyl-1-methylpyrrolidin-1-ium-2-yl]methanol;[(2S)-1-benzylpyrrolidin-2-yl]methanol;methane |
| SMILES | C.C[N+]1(Cc2ccccc2)CCC[C@H]1CO.OC[C@@H]1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C13H20NO.C12H17NO.CH4/c1-14(9-5-8-13(14)11-15)10-12-6-3-2-4-7-12;14-10-12-7-4-8-13(12)9-11-5-2-1-3-6-11;/h2-4,6-7,13,15H,5,8-11H2,1H3;1-3,5-6,12,14H,4,7-10H2;1H4/q+1;;/t13-,14?;12-;/m00./s1 |
| InChIKey | VHJCOTKFJVQUFN-KZRNPKJBSA-N |
| XLogP | 4.07 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|