C14H22Cl2 — CID 161304171
5,5-dichloro-6-octan-4-ylcyclohexa-1,3-diene (PubChem CID 161304171) has the molecular formula C14H22Cl2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 5,5-dichloro-6-octan-4-ylcyclohexa-1,3-diene.
| Compound Name | 5,5-dichloro-6-octan-4-ylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 161304171 |
| Molecular Formula | C14H22Cl2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 5,5-dichloro-6-octan-4-ylcyclohexa-1,3-diene |
| SMILES | CCCCC(CCC)C1C=CC=CC1(Cl)Cl |
| InChI | InChI=1S/C14H22Cl2/c1-3-5-9-12(8-4-2)13-10-6-7-11-14(13,15)16/h6-7,10-13H,3-5,8-9H2,1-2H3 |
| InChIKey | VIAFGLRYKQDTNH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|