C36H47N9O6 — CID 161304593
1-(2-methoxyethyl)-5-nitro-3-propylindazole;1-(2-methoxyethyl)-3-propylindazol-5-amine;5-nitro-3-propyl-2H-indazole (PubChem CID 161304593) has the molecular formula C36H47N9O6 and a molecular weight of 701.83 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-5-nitro-3-propylindazole;1-(2-methoxyethyl)-3-propylindazol-5-amine;5-nitro-3-propyl-2H-indazole.
| Compound Name | 1-(2-methoxyethyl)-5-nitro-3-propylindazole;1-(2-methoxyethyl)-3-propylindazol-5-amine;5-nitro-3-propyl-2H-indazole |
|---|---|
| PubChem CID | 161304593 |
| Molecular Formula | C36H47N9O6 |
| Molecular Weight | 701.83 g/mol |
| Exact Mass | 701.36 |
| IUPAC Name | 1-(2-methoxyethyl)-5-nitro-3-propylindazole;1-(2-methoxyethyl)-3-propylindazol-5-amine;5-nitro-3-propyl-2H-indazole |
| SMILES | CCCc1[nH]nc2ccc([N+](=O)[O-])cc12.CCCc1nn(CCOC)c2ccc(N)cc12.CCCc1nn(CCOC)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C13H17N3O3.C13H19N3O.C10H11N3O2/c1-3-4-12-11-9-10(16(17)18)5-6-13(11)15(14-12)7-8-19-2;1-3-4-12-11-9-10(14)5-6-13(11)16(15-12)7-8-17-2;1-2-3-9-8-6-7(13(14)15)4-5-10(8)12-11-9/h5-6,9H,3-4,7-8H2,1-2H3;5-6,9H,3-4,7-8,14H2,1-2H3;4-6H,2-3H2,1H3,(H,11,12) |
| InChIKey | VIBQNWLZLUFHJO-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 195.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.83 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|