C31H35BBr2N6O2 — CID 161306910
5-bromo-1-ethylindazole;5-bromo-1H-indazole;1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 161306910) has the molecular formula C31H35BBr2N6O2 and a molecular weight of 694.28 g/mol. Its IUPAC name is 5-bromo-1-ethylindazole;5-bromo-1H-indazole;1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 5-bromo-1-ethylindazole;5-bromo-1H-indazole;1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 161306910 |
| Molecular Formula | C31H35BBr2N6O2 |
| Molecular Weight | 694.28 g/mol |
| Exact Mass | 692.13 |
| IUPAC Name | 5-bromo-1-ethylindazole;5-bromo-1H-indazole;1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Brc1ccc2[nH]ncc2c1.CCn1ncc2cc(B3OC(C)(C)C(C)(C)O3)ccc21.CCn1ncc2cc(Br)ccc21 |
| InChI | InChI=1S/C15H21BN2O2.C9H9BrN2.C7H5BrN2/c1-6-18-13-8-7-12(9-11(13)10-17-18)16-19-14(2,3)15(4,5)20-16;1-2-12-9-4-3-8(10)5-7(9)6-11-12;8-6-1-2-7-5(3-6)4-9-10-7/h7-10H,6H2,1-5H3;3-6H,2H2,1H3;1-4H,(H,9,10) |
| InChIKey | VIJHOYLZBHFWPX-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.28 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|