C15H19F3O4 — CID 161308899
2-[2-(3-methoxypropoxy)-4-(trifluoromethyl)phenyl]-2-methyl-1,3-dioxolane (PubChem CID 161308899) has the molecular formula C15H19F3O4 and a molecular weight of 320.31 g/mol. Its IUPAC name is 2-[2-(3-methoxypropoxy)-4-(trifluoromethyl)phenyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[2-(3-methoxypropoxy)-4-(trifluoromethyl)phenyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 161308899 |
| Molecular Formula | C15H19F3O4 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[2-(3-methoxypropoxy)-4-(trifluoromethyl)phenyl]-2-methyl-1,3-dioxolane |
| SMILES | COCCCOc1cc(C(F)(F)F)ccc1C1(C)OCCO1 |
| InChI | InChI=1S/C15H19F3O4/c1-14(21-8-9-22-14)12-5-4-11(15(16,17)18)10-13(12)20-7-3-6-19-2/h4-5,10H,3,6-9H2,1-2H3 |
| InChIKey | VIPVMZKAUUDEGP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|