C28H39NO3Si — CID 161311223
tert-butyl N-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexen-1-yl]carbamate (PubChem CID 161311223) has the molecular formula C28H39NO3Si and a molecular weight of 465.71 g/mol. Its IUPAC name is tert-butyl N-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexen-1-yl]carbamate.
| Compound Name | tert-butyl N-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexen-1-yl]carbamate |
|---|---|
| PubChem CID | 161311223 |
| Molecular Formula | C28H39NO3Si |
| Molecular Weight | 465.71 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | tert-butyl N-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclohexen-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=CCCC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C28H39NO3Si/c1-27(2,3)32-26(30)29-23-15-13-14-22(20-23)21-31-33(28(4,5)6,24-16-9-7-10-17-24)25-18-11-8-12-19-25/h7-12,15-19,22H,13-14,20-21H2,1-6H3,(H,29,30) |
| InChIKey | VIXJUCZNPBHCIQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.71 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|