C40H27ClN4O — CID 161311284
2-chloro-4,6-diphenylquinazoline;4,6-diphenyl-1H-quinazolin-2-one (PubChem CID 161311284) has the molecular formula C40H27ClN4O and a molecular weight of 615.14 g/mol. Its IUPAC name is 2-chloro-4,6-diphenylquinazoline;4,6-diphenyl-1H-quinazolin-2-one.
| Compound Name | 2-chloro-4,6-diphenylquinazoline;4,6-diphenyl-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 161311284 |
| Molecular Formula | C40H27ClN4O |
| Molecular Weight | 615.14 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | 2-chloro-4,6-diphenylquinazoline;4,6-diphenyl-1H-quinazolin-2-one |
| SMILES | Clc1nc(-c2ccccc2)c2cc(-c3ccccc3)ccc2n1.O=c1nc(-c2ccccc2)c2cc(-c3ccccc3)ccc2[nH]1 |
| InChI | InChI=1S/C20H13ClN2.C20H14N2O/c21-20-22-18-12-11-16(14-7-3-1-4-8-14)13-17(18)19(23-20)15-9-5-2-6-10-15;23-20-21-18-12-11-16(14-7-3-1-4-8-14)13-17(18)19(22-20)15-9-5-2-6-10-15/h1-13H;1-13H,(H,21,22,23) |
| InChIKey | VIXOQVBCGWMVNL-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.14 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |