About 2,6-dimethylphenolate phenoxide
2,6-dimethylphenolate phenoxide (PubChem CID 161319197) has the molecular formula C14H14O2-2
and a molecular weight of 214.26 g/mol. Its IUPAC name is 2,6-dimethylphenolate phenoxide.
Molecular Properties
| Compound Name | 2,6-dimethylphenolate phenoxide |
| PubChem CID | 161319197 |
| Molecular Formula | C14H14O2-2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2,6-dimethylphenolate phenoxide |
| SMILES | Cc1cccc(C)c1[O-].[O-]c1ccccc1 |
| InChI | InChI=1S/C8H10O.C6H6O/c1-6-4-3-5-7(2)8(6)9;7-6-4-2-1-3-5-6/h3-5,9H,1-2H3;1-5,7H/p-2 |
| InChIKey | VJXIZXJHJXDYGJ-UHFFFAOYSA-L |
| XLogP | 2.14 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethylphenolate phenoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylphenolate phenoxide?
The IUPAC name of 2,6-dimethylphenolate phenoxide (CID 161319197) is 2,6-dimethylphenolate phenoxide.
What is the SMILES notation for 2,6-dimethylphenolate phenoxide?
The canonical SMILES for 2,6-dimethylphenolate phenoxide is Cc1cccc(C)c1[O-].[O-]c1ccccc1.
What is the InChIKey of 2,6-dimethylphenolate phenoxide?
The InChIKey is VJXIZXJHJXDYGJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H10O.C6H6O/c1-6-4-3-5-7(2)8(6)9;7-6-4-2-1-3-5-6/h3-5,9H,1-2H3;1-5,7H/p-2.
What are the key properties of 2,6-dimethylphenolate phenoxide?
2,6-dimethylphenolate phenoxide has a molecular weight of 214.26 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylphenolate phenoxide is sourced from PubChem (CID 161319197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).