C19H22ClN3O3 — CID 161319932
1-[1-[4-[(4-chloro-3-methylphenyl)methoxy]piperidine-1-carbonyl]pyrazol-3-yl]ethanone (PubChem CID 161319932) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is 1-[1-[4-[(4-chloro-3-methylphenyl)methoxy]piperidine-1-carbonyl]pyrazol-3-yl]ethanone.
| Compound Name | 1-[1-[4-[(4-chloro-3-methylphenyl)methoxy]piperidine-1-carbonyl]pyrazol-3-yl]ethanone |
|---|---|
| PubChem CID | 161319932 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-[1-[4-[(4-chloro-3-methylphenyl)methoxy]piperidine-1-carbonyl]pyrazol-3-yl]ethanone |
| SMILES | CC(=O)c1ccn(C(=O)N2CCC(OCc3ccc(Cl)c(C)c3)CC2)n1 |
| InChI | InChI=1S/C19H22ClN3O3/c1-13-11-15(3-4-17(13)20)12-26-16-5-8-22(9-6-16)19(25)23-10-7-18(21-23)14(2)24/h3-4,7,10-11,16H,5-6,8-9,12H2,1-2H3 |
| InChIKey | ZERYJMNCIYVWLR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |