C17H19Cl2N3O4 — CID 170014379
[4-[(3,5-dichlorophenyl)methoxy]piperidin-1-yl]-[3-(dihydroxymethyl)pyrazol-1-yl]methanone (PubChem CID 170014379) has the molecular formula C17H19Cl2N3O4 and a molecular weight of 400.26 g/mol. Its IUPAC name is [4-[(3,5-dichlorophenyl)methoxy]piperidin-1-yl]-[3-(dihydroxymethyl)pyrazol-1-yl]methanone.
| Compound Name | [4-[(3,5-dichlorophenyl)methoxy]piperidin-1-yl]-[3-(dihydroxymethyl)pyrazol-1-yl]methanone |
|---|---|
| PubChem CID | 170014379 |
| Molecular Formula | C17H19Cl2N3O4 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | [4-[(3,5-dichlorophenyl)methoxy]piperidin-1-yl]-[3-(dihydroxymethyl)pyrazol-1-yl]methanone |
| SMILES | O=C(N1CCC(OCc2cc(Cl)cc(Cl)c2)CC1)n1ccc(C(O)O)n1 |
| InChI | InChI=1S/C17H19Cl2N3O4/c18-12-7-11(8-13(19)9-12)10-26-14-1-4-21(5-2-14)17(25)22-6-3-15(20-22)16(23)24/h3,6-9,14,16,23-24H,1-2,4-5,10H2 |
| InChIKey | QYZSHOQIXWFDAV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|