C47H69N3O13 — CID 161320345
5-(1-hydroxy-4-phenylmethoxybutyl)pyrrolidin-2-one;methyl 4-amino-5-hydroxy-8-phenylmethoxyoctanoate;methyl 5-hydroxy-4-nitro-8-phenylmethoxyoctanoate (PubChem CID 161320345) has the molecular formula C47H69N3O13 and a molecular weight of 884.08 g/mol. Its IUPAC name is 5-(1-hydroxy-4-phenylmethoxybutyl)pyrrolidin-2-one;methyl 4-amino-5-hydroxy-8-phenylmethoxyoctanoate;methyl 5-hydroxy-4-nitro-8-phenylmethoxyoctanoate.
| Compound Name | 5-(1-hydroxy-4-phenylmethoxybutyl)pyrrolidin-2-one;methyl 4-amino-5-hydroxy-8-phenylmethoxyoctanoate;methyl 5-hydroxy-4-nitro-8-phenylmethoxyoctanoate |
|---|---|
| PubChem CID | 161320345 |
| Molecular Formula | C47H69N3O13 |
| Molecular Weight | 884.08 g/mol |
| Exact Mass | 883.48 |
| IUPAC Name | 5-(1-hydroxy-4-phenylmethoxybutyl)pyrrolidin-2-one;methyl 4-amino-5-hydroxy-8-phenylmethoxyoctanoate;methyl 5-hydroxy-4-nitro-8-phenylmethoxyoctanoate |
| SMILES | COC(=O)CCC(C(O)CCCOCc1ccccc1)[N+](=O)[O-].COC(=O)CCC(N)C(O)CCCOCc1ccccc1.O=C1CCC(C(O)CCCOCc2ccccc2)N1 |
| InChI | InChI=1S/C16H23NO6.C16H25NO4.C15H21NO3/c1-22-16(19)10-9-14(17(20)21)15(18)8-5-11-23-12-13-6-3-2-4-7-13;1-20-16(19)10-9-14(17)15(18)8-5-11-21-12-13-6-3-2-4-7-13;17-14(13-8-9-15(18)16-13)7-4-10-19-11-12-5-2-1-3-6-12/h2-4,6-7,14-15,18H,5,8-12H2,1H3;2-4,6-7,14-15,18H,5,8-12,17H2,1H3;1-3,5-6,13-14,17H,4,7-11H2,(H,16,18) |
| InChIKey | VKBDEDCBUHUUGB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 239.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.08 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|