C27H42ClN7O6 — CID 161321620
2-methyl-7-[4-(oxetan-3-yloxymethyl)triazol-1-yl]hept-1-en-3-one;2-methylprop-2-enoyl chloride;3-[4-(oxetan-3-yloxymethyl)triazol-1-yl]propan-1-amine (PubChem CID 161321620) has the molecular formula C27H42ClN7O6 and a molecular weight of 596.13 g/mol. Its IUPAC name is 2-methyl-7-[4-(oxetan-3-yloxymethyl)triazol-1-yl]hept-1-en-3-one;2-methylprop-2-enoyl chloride;3-[4-(oxetan-3-yloxymethyl)triazol-1-yl]propan-1-amine.
| Compound Name | 2-methyl-7-[4-(oxetan-3-yloxymethyl)triazol-1-yl]hept-1-en-3-one;2-methylprop-2-enoyl chloride;3-[4-(oxetan-3-yloxymethyl)triazol-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 161321620 |
| Molecular Formula | C27H42ClN7O6 |
| Molecular Weight | 596.13 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | 2-methyl-7-[4-(oxetan-3-yloxymethyl)triazol-1-yl]hept-1-en-3-one;2-methylprop-2-enoyl chloride;3-[4-(oxetan-3-yloxymethyl)triazol-1-yl]propan-1-amine |
| SMILES | C=C(C)C(=O)CCCCn1cc(COC2COC2)nn1.C=C(C)C(=O)Cl.NCCCn1cc(COC2COC2)nn1 |
| InChI | InChI=1S/C14H21N3O3.C9H16N4O2.C4H5ClO/c1-11(2)14(18)5-3-4-6-17-7-12(15-16-17)8-20-13-9-19-10-13;10-2-1-3-13-4-8(11-12-13)5-15-9-6-14-7-9;1-3(2)4(5)6/h7,13H,1,3-6,8-10H2,2H3;4,9H,1-3,5-7,10H2;1H2,2H3 |
| InChIKey | VKFIZYHFGSWKLN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 158.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.13 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|