C22H19F3O4 — CID 161326997
2H-chromene-3-carboxylic acid;2-ethyl-2-(trifluoromethyl)chromene (PubChem CID 161326997) has the molecular formula C22H19F3O4 and a molecular weight of 404.38 g/mol. Its IUPAC name is 2H-chromene-3-carboxylic acid;2-ethyl-2-(trifluoromethyl)chromene.
| Compound Name | 2H-chromene-3-carboxylic acid;2-ethyl-2-(trifluoromethyl)chromene |
|---|---|
| PubChem CID | 161326997 |
| Molecular Formula | C22H19F3O4 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2H-chromene-3-carboxylic acid;2-ethyl-2-(trifluoromethyl)chromene |
| SMILES | CCC1(C(F)(F)F)C=Cc2ccccc2O1.O=C(O)C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C12H11F3O.C10H8O3/c1-2-11(12(13,14)15)8-7-9-5-3-4-6-10(9)16-11;11-10(12)8-5-7-3-1-2-4-9(7)13-6-8/h3-8H,2H2,1H3;1-5H,6H2,(H,11,12) |
| InChIKey | VKXBOSCFWAXTIM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |