C23H29Cl3O6 — CID 161329468
benzyl benzoate;ethyl 2-hydroxypropanoate;1,1,1-trichloro-2-methylpropan-2-ol (PubChem CID 161329468) has the molecular formula C23H29Cl3O6 and a molecular weight of 507.84 g/mol. Its IUPAC name is benzyl benzoate;ethyl 2-hydroxypropanoate;1,1,1-trichloro-2-methylpropan-2-ol.
| Compound Name | benzyl benzoate;ethyl 2-hydroxypropanoate;1,1,1-trichloro-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 161329468 |
| Molecular Formula | C23H29Cl3O6 |
| Molecular Weight | 507.84 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | benzyl benzoate;ethyl 2-hydroxypropanoate;1,1,1-trichloro-2-methylpropan-2-ol |
| SMILES | CC(C)(O)C(Cl)(Cl)Cl.CCOC(=O)C(C)O.O=C(OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O2.C5H10O3.C4H7Cl3O/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12;1-3-8-5(7)4(2)6;1-3(2,8)4(5,6)7/h1-10H,11H2;4,6H,3H2,1-2H3;8H,1-2H3 |
| InChIKey | VLFNGLLJXHZWGB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.84 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|