C38H44 — CID 161333724
10,10-dimethyl-9H-anthracene;1,1-dimethylcyclopentane;9,9-dimethylfluorene (PubChem CID 161333724) has the molecular formula C38H44 and a molecular weight of 500.77 g/mol. Its IUPAC name is 10,10-dimethyl-9H-anthracene;1,1-dimethylcyclopentane;9,9-dimethylfluorene.
| Compound Name | 10,10-dimethyl-9H-anthracene;1,1-dimethylcyclopentane;9,9-dimethylfluorene |
|---|---|
| PubChem CID | 161333724 |
| Molecular Formula | C38H44 |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | 10,10-dimethyl-9H-anthracene;1,1-dimethylcyclopentane;9,9-dimethylfluorene |
| SMILES | CC1(C)CCCC1.CC1(C)c2ccccc2-c2ccccc21.CC1(C)c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C16H16.C15H14.C7H14/c1-16(2)14-9-5-3-7-12(14)11-13-8-4-6-10-15(13)16;1-15(2)13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-7(2)5-3-4-6-7/h3-10H,11H2,1-2H3;3-10H,1-2H3;3-6H2,1-2H3 |
| InChIKey | VLTFTPCODNWKLE-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |