C24H33N3O3 — CID 161336935
(4aR,8aS)-6-[4-[(5-cyclopropyl-4-methyl-3-pyridinyl)methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 161336935) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is (4aR,8aS)-6-[4-[(5-cyclopropyl-4-methyl-3-pyridinyl)methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[4-[(5-cyclopropyl-4-methyl-3-pyridinyl)methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 161336935 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | (4aR,8aS)-6-[4-[(5-cyclopropyl-4-methyl-3-pyridinyl)methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | Cc1c(CC2CCN(C(=O)N3CC[C@@H]4OCC(=O)C[C@@H]4C3)CC2)cncc1C1CC1 |
| InChI | InChI=1S/C24H33N3O3/c1-16-19(12-25-13-22(16)18-2-3-18)10-17-4-7-26(8-5-17)24(29)27-9-6-23-20(14-27)11-21(28)15-30-23/h12-13,17-18,20,23H,2-11,14-15H2,1H3/t20-,23+/m1/s1 |
| InChIKey | VMDRDKVZYQURGZ-OFNKIYASSA-N |
| XLogP | 3.32 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |