C30H44ClN3O4Si — CID 157103924
(4aR,8aS)-6-[4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-chloroindol-3-yl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 157103924) has the molecular formula C30H44ClN3O4Si and a molecular weight of 574.24 g/mol. Its IUPAC name is (4aR,8aS)-6-[4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-chloroindol-3-yl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-chloroindol-3-yl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 157103924 |
| Molecular Formula | C30H44ClN3O4Si |
| Molecular Weight | 574.24 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | (4aR,8aS)-6-[4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-chloroindol-3-yl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1cc(C2CCN(C(=O)N3CC[C@@H]4OCC(=O)C[C@@H]4C3)CC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C30H44ClN3O4Si/c1-30(2,3)39(4,5)38-15-14-33-19-26(25-17-23(31)6-7-27(25)33)21-8-11-32(12-9-21)29(36)34-13-10-28-22(18-34)16-24(35)20-37-28/h6-7,17,19,21-22,28H,8-16,18,20H2,1-5H3/t22-,28+/m1/s1 |
| InChIKey | AGBURLFIKYGQNV-DFHRPNOPSA-N |
| XLogP | 6.30 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.24 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|