C29H38ClN5O5 — CID 156674361
tert-butyl 3-[5-chloro-3-[1-(3-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carbonyl)piperidin-4-yl]indol-1-yl]azetidine-1-carboxylate (PubChem CID 156674361) has the molecular formula C29H38ClN5O5 and a molecular weight of 572.11 g/mol. Its IUPAC name is tert-butyl 3-[5-chloro-3-[1-(3-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carbonyl)piperidin-4-yl]indol-1-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[5-chloro-3-[1-(3-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carbonyl)piperidin-4-yl]indol-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 156674361 |
| Molecular Formula | C29H38ClN5O5 |
| Molecular Weight | 572.11 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | tert-butyl 3-[5-chloro-3-[1-(3-oxo-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazine-6-carbonyl)piperidin-4-yl]indol-1-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(n2cc(C3CCN(C(=O)N4CCC5OCC(=O)NC5C4)CC3)c3cc(Cl)ccc32)C1 |
| InChI | InChI=1S/C29H38ClN5O5/c1-29(2,3)40-28(38)34-13-20(14-34)35-15-22(21-12-19(30)4-5-24(21)35)18-6-9-32(10-7-18)27(37)33-11-8-25-23(16-33)31-26(36)17-39-25/h4-5,12,15,18,20,23,25H,6-11,13-14,16-17H2,1-3H3,(H,31,36) |
| InChIKey | DZRFPRUTLKTYKC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.11 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |