About ethenylbenzene;2H-isoindole;tungsten(2+)
ethenylbenzene;2H-isoindole;tungsten(2+) (PubChem CID 161337347) has the molecular formula C16H13NW
and a molecular weight of 403.13 g/mol. Its IUPAC name is ethenylbenzene;2H-isoindole;tungsten(2+).
Molecular Properties
| Compound Name | ethenylbenzene;2H-isoindole;tungsten(2+) |
| PubChem CID | 161337347 |
| Molecular Formula | C16H13NW |
| Molecular Weight | 403.13 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | ethenylbenzene;2H-isoindole;tungsten(2+) |
| SMILES | [H]/[C-]=C/c1[c-]cccc1.[W+2].c1ccc2c[nH]cc2c1 |
| InChI | InChI=1S/C8H7N.C8H6.W/c1-2-4-8-6-9-5-7(8)3-1;1-2-8-6-4-3-5-7-8;/h1-6,9H;1-6H;/q;-2;+2 |
| InChIKey | VXOQSCZHTYLAAO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.13 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethenylbenzene;2H-isoindole;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylbenzene;2H-isoindole;tungsten(2+)?
The IUPAC name of ethenylbenzene;2H-isoindole;tungsten(2+) (CID 161337347) is ethenylbenzene;2H-isoindole;tungsten(2+).
What is the SMILES notation for ethenylbenzene;2H-isoindole;tungsten(2+)?
The canonical SMILES for ethenylbenzene;2H-isoindole;tungsten(2+) is [H]/[C-]=C/c1[c-]cccc1.[W+2].c1ccc2c[nH]cc2c1.
What is the InChIKey of ethenylbenzene;2H-isoindole;tungsten(2+)?
The InChIKey is VXOQSCZHTYLAAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C8H6.W/c1-2-4-8-6-9-5-7(8)3-1;1-2-8-6-4-3-5-7-8;/h1-6,9H;1-6H;/q;-2;+2.
What are the key properties of ethenylbenzene;2H-isoindole;tungsten(2+)?
ethenylbenzene;2H-isoindole;tungsten(2+) has a molecular weight of 403.13 g/mol, XLogP of 4.10, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylbenzene;2H-isoindole;tungsten(2+) is sourced from PubChem (CID 161337347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).